Concept explainers
(a)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(b)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(c)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(d)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(e)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(f)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(g)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(h)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(i)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
(j)
Interpretation:
The Lewis structure of the reactant and the product, the species that are acting as electrophiles and nucleophiles and the reaction that is best termed as Bronsted-Lowry acid-base reaction is to be stated.
Concept introduction:
The Bronsted-Lowry theory depends on the transfer of proton from an acid to base and pair of nonbonding electrons is used by the base to form a bond. A nucleophile is a nuclei loving species as it donates an electron to an atom with a vacant orbital whereas an electrophile accepts the electron pairs.
Want to see the full answer?
Check out a sample textbook solutionChapter 2 Solutions
Organic Chemistry (9th Edition)
- Select the stronger acid from pair and explain your reasoning. For stronger acid, write a structural formula for its conjugate base. Q.) CH3CH2OH or CH3C=(three sticks in equals)CHarrow_forwardComplete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardComplete the equation for the reaction between each Lewis acid-base pair. In each equation, label which starting material is the Lewis acid and which is the Lewis base; use curved arrows to show the flow of electrons in each reaction. In doing this problem, it is essential that you show valence electrons for all atoms participating in each reaction. (a) (b) (c) (d)arrow_forward
- Use curved arrows to show the most likely acid-base reaction between phenol and NaOH. a. Use pKa data to mark each curved arrow with a positive or negative energy change in pKa ,units. b. Calculate H for this reaction, and sketch an energy diagram showing H as an arrow onyour diagram.arrow_forwardComplete each Lewis structure, draw all important resonance structures, predict a value for thebond angles requested, and explain your reasoning. a. Nitrous acid (HNO2)HONOHON=ONO= b. Enolate ion (C2H3O) HC1C2=HC2C1=arrow_forwardFor the following acid-base reaction, predict the position of the equilibrium and identify the most stable base. + NaOH || A. favor the right side with compound I being the most stable base B. favor the right side with compound II being the most stable base OC. favor the right side with compound III being the most stable base OD. favor the left side with compound I being the most stable base E. favor the left side with compound II being the most stable base سمیر ||| + H₂O IVarrow_forward
- Write "most" under the compound which would be most reactive toward Bry/Feßry. Write "least" under the compound which would be least reactive toward Bry/FeBr). benzene benzoic acid phenol Write "highest" under the compound in the highest oxidation state. Write "lowest" under the one in the lowest oxidation state. CH Write "most" under the one which is most acidic. Write "least" under the one which is least acidic. cyclohexanol benzene OH phenol region.arrow_forwardDraw the organic product of the Bronsted acid-base reaction. Include all lone pairs and charges as appropriate. Ignore any counterions. H₂O* Drawing 'Harrow_forwardExplain why the pH of 0.1 M acetic acid (pH = 3) is higher than the pH of 0.1 M trifluoroacetic acid (pH = 1).arrow_forward
- Alkynes exhibit acidic properties because of the differences in the electronegativity of sp- hybridized carbons. Which of the following statements best explains the acidic property of acetylene? A. The electronegativity of sp hybridized carbon decreases bond dipole between C and H. B. Hydrogen atom becomes ionized due to sp-s repulsion. C. The sp-sp orbital overlap attracts the electron cloud between C and H. D. The pi bonds in the triple bond promote ionization of carbon into carbocationsarrow_forward4.) Phenol Why slightly soluble in water? Why insoluble in HCl? Why completely soluble in NaOH? Why insoluble in NaHCO?arrow_forward[Review Topics) [References) Answer questions a-c about the Bronsted acid-base reaction below using the identifying letters A-D below each structure. A table of pK, values for various organic and inorganic acids can be found in the references section. H2 H2 CH NH3 CH CH CH HO, B ethoxide C ethylammonium ethylamine ethanol a) The weaker acid is b) Its conjugate base is c) The species that predominate at equilibrium are (two letters, e.g. AC) Submit Answer Retry Entire Group 8 more group attempts remaining (Previou Email Instrui (? hp 12 fg fg f1o fsarrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningOrganic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage LearningPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
- Chemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage Learning