Enter electrons as e*. Use smallest possible integer coefficients for ALL reactions. If a box is not needed, leave it blank. A voltaic electrochemical cell is constructed in which the anode is a Co²+ | Co half cell and the cathode is a Cu2+ | Cu half cell. The half- cell compartments are connected by a salt bridge. Write the anode reaction. + Write the cathode reaction. + Write the net cell reaction. + + + electrode In the external circuit, electrons migrate | the Cu2+ cu electrode. + the Co2+/co In the salt bridge, anions migrate the Cu²+|Cu compartment the Co2+ co compartment.

Enter electrons as e*. Use smallest possible integer coefficients for ALL reactions. If a box is not needed, leave it blank. A voltaic electrochemical cell is constructed in which the anode is a Co²+ | Co half cell and the cathode is a Cu2+ | Cu half cell. The half- cell compartments are connected by a salt bridge. Write the anode reaction. + Write the cathode reaction. + Write the net cell reaction. + + + electrode In the external circuit, electrons migrate | the Cu2+ cu electrode. + the Co2+/co In the salt bridge, anions migrate the Cu²+|Cu compartment the Co2+ co compartment.

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter19: Principles Of Chemical Reactivity: Electron Transfer Reactions

Section: Chapter Questions

Problem 10PS: The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write...

See similar textbooks

Similar questions

Identify each statement as true or false. Rewrite each false statement to make it true. (a) Oxidation always occurs at the anode of an electrochemical cell. (b) The anode of a discharging voltaic cell is the site ofreduction and is negative. (c) Standard-state conditions for electrochemical cells are aconcentration of 1.0 M for dissolved species and a pressure of 1 bar for gases. (d) The potential of a voltaic cell does not change withtemperature. (e) All product-favored oxidation-reduction reactions have astandard cell potential Ecell, with a negative sign.
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
A voltaic cell is constructed using the reaction of chromium metal and iron(II) ions. 2 Cr(s) + 3 Fe2+(aq) 2 Cr3+(aq) + 3 Fe(s) Complete the following sentences: Electrons in the external circuit flow from the ________ electrode to the ______ electrode. Negative ions move in the salt bridge from the ________ half-cell to the ______ half-cell. The half-reaction at the anode is _______ and that at the cathode is ________.
The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ______ electrode to the ____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the _____ half-cell.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Give the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?